1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methoxybenzene structure
|
Common Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 362477-47-2 | Molecular Weight | 352.16700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11F6O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[bis(2,2,2-trifluoroethoxy)phosphoryl]-4-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11F6O4P |
|---|---|
| Molecular Weight | 352.16700 |
| Exact Mass | 352.03000 |
| PSA | 54.57000 |
| LogP | 3.67140 |
| InChIKey | UIPLWRUPEBEPQM-UHFFFAOYSA-N |
| SMILES | COc1ccc(P(=O)(OCC(F)(F)F)OCC(F)(F)F)cc1 |
|
~83%
1-[bis(2,2,2-tr... CAS#:362477-47-2 |
| Literature: Sawa, Masaaki; Tsukamoto, Takako; Kiyoi, Takao; Kurokawa, Kiriko; Nakajima, Fumio; Nakada, Yuichiro; Yokota, Koichi; Inoue, Yoshimasa; Kondo, Hirosato; Yoshino, Kohichiro Journal of Medicinal Chemistry, 2002 , vol. 45, # 4 p. 930 - 936 |
|
~%
1-[bis(2,2,2-tr... CAS#:362477-47-2 |
| Literature: Sawa, Masaaki; Kondo, Hirosato; Nishimura, Shinichiro Bioorganic and Medicinal Chemistry Letters, 2002 , vol. 12, # 4 p. 581 - 584 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-methoxyphenyl)phosphonic acid bis(2,2,2-trifluoroethyl) ester |
| Phosphonic acid,(4-methoxyphenyl)-,bis(2,2,2-trifluoroethyl) ester |