3-(4-Trifluoromethylphenyl)-1H-pyrazole structure
|
Common Name | 3-(4-Trifluoromethylphenyl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 362601-71-6 | Molecular Weight | 212.171 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 316.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C10H7F3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.4±26.5 °C | |
| Name | 5-[4-(trifluoromethyl)phenyl]-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 316.8±37.0 °C at 760 mmHg |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.171 |
| Flash Point | 145.4±26.5 °C |
| Exact Mass | 212.056137 |
| PSA | 28.68000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | MNOULQLXILYKNV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(-c2ccn[nH]2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~%
3-(4-Trifluorom... CAS#:362601-71-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 15 p. 3540 - 3546 |
|
~%
3-(4-Trifluorom... CAS#:362601-71-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 15 p. 3540 - 3546 |
|
~%
3-(4-Trifluorom... CAS#:362601-71-6 |
| Literature: Molecules, , vol. 16, # 11 p. 9340 - 9356 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-[4-(Trifluoromethyl)phenyl]-1H-pyrazole |
| 5-(4-(trifluoromethyl)phenyl)-1H-pyrazole |
| 1H-Pyrazole, 3-[4-(trifluoromethyl)phenyl]- |
| 3-(4-Trifluoromethylphenyl)-1H-pyrazole |
| 3-(4-Trifluoromethylphenyl)pyrazole |