8-(2-NAPHTHYL)-8-OXOOCTANOIC ACID structure
|
Common Name | 8-(2-NAPHTHYL)-8-OXOOCTANOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 362669-52-1 | Molecular Weight | 284.35000 | |
| Density | 1.143g/cm3 | Boiling Point | 495.69ºC at 760 mmHg | |
| Molecular Formula | C18H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.681ºC | |
| Name | 8-naphthalen-2-yl-8-oxooctanoic acid |
|---|
| Density | 1.143g/cm3 |
|---|---|
| Boiling Point | 495.69ºC at 760 mmHg |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35000 |
| Flash Point | 267.681ºC |
| Exact Mass | 284.14100 |
| PSA | 54.37000 |
| LogP | 4.44770 |
| Index of Refraction | 1.586 |
| InChIKey | QGDXRNDAAVAQIV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCC(=O)c1ccc2ccccc2c1 |
| HS Code | 2918300090 |
|---|
|
~%
8-(2-NAPHTHYL)-... CAS#:362669-52-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 1 p. 283 - 287 |
|
~%
8-(2-NAPHTHYL)-... CAS#:362669-52-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 1 p. 283 - 287 |
|
~%
8-(2-NAPHTHYL)-... CAS#:362669-52-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 45, # 13 p. 2877 - 2885 |
|
~%
8-(2-NAPHTHYL)-... CAS#:362669-52-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 1 p. 283 - 287 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |