phenyl 4-chloro-1-hydroxy-2-naphthoate structure
|
Common Name | phenyl 4-chloro-1-hydroxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 36268-75-4 | Molecular Weight | 298.72000 | |
| Density | 1.374 g/cm3 | Boiling Point | 461.7ºC at 760 mmHg | |
| Molecular Formula | C17H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233ºC | |
| Name | phenyl 4-chloro-1-hydroxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374 g/cm3 |
|---|---|
| Boiling Point | 461.7ºC at 760 mmHg |
| Molecular Formula | C17H11ClO3 |
| Molecular Weight | 298.72000 |
| Flash Point | 233ºC |
| Exact Mass | 298.04000 |
| PSA | 46.53000 |
| LogP | 4.41800 |
| Index of Refraction | 1.684 |
| InChIKey | PRPJEXLNOGLBCN-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c1cc(Cl)c2ccccc2c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Phenyl 4-chloro-1-hydroxy-2-naphthoate |