2-[N-(2-methylphenyl)methanesulfonamido]acetic acid structure
|
Common Name | 2-[N-(2-methylphenyl)methanesulfonamido]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 362695-40-7 | Molecular Weight | 243.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-Methylphenyl)-N-(methylsulfonyl)glycine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13NO4S |
|---|---|
| Molecular Weight | 243.28000 |
| Exact Mass | 243.05700 |
| PSA | 83.06000 |
| LogP | 1.92640 |
| InChIKey | LEVCNLAVCPFSPL-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1N(CC(=O)O)S(C)(=O)=O |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD02219537 |