tert-butyl 4-amino-4-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-amino-4-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 362703-57-9 | Molecular Weight | 272.34100 | |
| Density | 1.096g/cm3 | Boiling Point | 348.4ºC at 760mmHg | |
| Molecular Formula | C13H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.5ºC | |
| Name | tert-butyl 4-amino-4-(2-methoxy-2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.096g/cm3 |
|---|---|
| Boiling Point | 348.4ºC at 760mmHg |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34100 |
| Flash Point | 164.5ºC |
| Exact Mass | 272.17400 |
| PSA | 81.86000 |
| LogP | 1.91610 |
| Index of Refraction | 1.48 |
| InChIKey | UJWYRWKTHZQRLH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1(N)CCN(C(=O)OC(C)(C)C)CC1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-amino-4-methoxycarbonylmethyl-piperidine-1-carboxylic acid tert-butyl ester |