1-(Chloromethyl)-1,4-diazabicyclo[2.2.2]octan-1-ium chloride structure
|
Common Name | 1-(Chloromethyl)-1,4-diazabicyclo[2.2.2]octan-1-ium chloride | ||
|---|---|---|---|---|
| CAS Number | 36273-11-7 | Molecular Weight | 197.10500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14Cl2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(chloromethyl)-1-aza-4-azoniabicyclo[2.2.2]octane,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H14Cl2N2 |
|---|---|
| Molecular Weight | 197.10500 |
| Exact Mass | 196.05300 |
| PSA | 3.24000 |
| InChIKey | RKVXEZAWSNSRPA-UHFFFAOYSA-M |
| SMILES | ClC[N+]12CCN(CC1)CC2.[Cl-] |
| HS Code | 2933990090 |
|---|
|
~80%
1-(Chloromethyl... CAS#:36273-11-7 |
| Literature: Journal of Fluorine Chemistry, , vol. 81, # 1 p. 43 - 50 |
|
~%
1-(Chloromethyl... CAS#:36273-11-7 |
| Literature: Tetrahedron, , vol. 42, # 2 p. 601 - 608 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(chloromethyl)-4-aza-1-azonia bicyclo[2.2.2]octane chloride |
| 4-Aza-1-azoniabicyclo(2.2.2)octane,1-(chloromethyl)-,chloride (1:1) |
| 4-Aza-1-azoniabicyclo(2.2.2)octane,1-(chloromethyl)-,chloride |
| 1-chloromethyl-1-azonia-4-azobicyclo< 1-(chloromethyl)-1,4-diazabicyclo[2.2.2]octan-1-ium chloride |