2-acetamido-2-[(5-fluoro-1H-indol-3-yl)methyl]propanedioic acid
Modify Date: 2025-08-27 12:34:59
![2-acetamido-2-[(5-fluoro-1H-indol-3-yl)methyl]propanedioic acid Structure](https://image.chemsrc.com/caspic/173/363-37-1.png)
2-acetamido-2-[(5-fluoro-1H-indol-3-yl)methyl]propanedioic acid structure
|
Common Name | 2-acetamido-2-[(5-fluoro-1H-indol-3-yl)methyl]propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 363-37-1 | Molecular Weight | 308.26200 | |
| Density | 1.54g/cm3 | Boiling Point | 663.1ºC at 760 mmHg | |
| Molecular Formula | C14H13FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.8ºC | |
| Name | 2-acetamido-2-[(5-fluoro-1H-indol-3-yl)methyl]propanedioic acid |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 663.1ºC at 760 mmHg |
| Molecular Formula | C14H13FN2O5 |
| Molecular Weight | 308.26200 |
| Flash Point | 354.8ºC |
| Exact Mass | 308.08100 |
| PSA | 119.49000 |
| LogP | 1.28450 |
| Index of Refraction | 1.653 |
| InChIKey | DVEDTOQBOJHUHB-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccc(F)cc12)(C(=O)O)C(=O)O |
|
~%
2-acetamido-2-[... CAS#:363-37-1 |
| Literature: Rinderknecht; Niemann Journal of the American Chemical Society, 1950 , vol. 72, p. 2296 |
|
~%
2-acetamido-2-[... CAS#:363-37-1 |
| Literature: Rinderknecht; Niemann Journal of the American Chemical Society, 1950 , vol. 72, p. 2296 |
|
~%
2-acetamido-2-[... CAS#:363-37-1 |
| Literature: Rinderknecht; Niemann Journal of the American Chemical Society, 1950 , vol. 72, p. 2296 |
![acetylamino-[3-(4-fluoro-phenylhydrazono)-propyl]-malonic acid diethyl ester structure](https://image.chemsrc.com/caspic/344/427-87-2.png)
CAS#:154-08-5