N-butyl(o-amino)phenol
N-butyl(o-amino)phenol structure
|
Common Name | N-butyl(o-amino)phenol | ||
|---|---|---|---|---|
| CAS Number | 428-79-5 | Molecular Weight | 364.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-Butyl(o-amino)phenol, also known as N-Butylbenzylphenol, has a CAS number of 428-79-5, with a molecular formula of C18H21FN2O5 and a molecular weight of 364.36800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-butyl(o-amino)phenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21FN2O5 |
|---|---|
| Molecular Weight | 364.36800 |
| Exact Mass | 364.14300 |
| PSA | 97.49000 |
| LogP | 2.24150 |
| InChIKey | UWEOXZHLNHALLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1c[nH]c2ccc(F)cc12)(NC(C)=O)C(=O)OCC |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![2-acetamido-2-[(5-fluoro-1H-indol-3-yl)methyl]propanedioic acid structure](https://image.chemsrc.com/caspic/173/363-37-1.png)
CAS#:363-37-1
CAS#:154-08-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-butylaminophenol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-butyl(o-amino)phenol have? |
| A: English synonyms of N-butyl(o-amino)phenol: N-butylaminophenol. |
| Q: What is the SMILES notation of N-butyl(o-amino)phenol? |
| A: SMILES notation of N-butyl(o-amino)phenol is CCOC(=O)C(Cc1c[nH]c2ccc(F)cc12)(NC(C)=O)C(=O)OCC. |
| Q: What is the molecular weight of N-butyl(o-amino)phenol? |
| A: Molecular weight of N-butyl(o-amino)phenol is 364.36800. |
| Q: What is the English name of N-butyl(o-amino)phenol? |
| A: The English name of N-butyl(o-amino)phenol is N-butyl(o-amino)phenol. |
| Q: What is the Chinese name of 428-79-5? |
| A: Chinese name of 428-79-5 is 428-79-5. |
| Q: What is the molecular formula of N-butyl(o-amino)phenol? |
| A: Molecular formula of N-butyl(o-amino)phenol is C18H21FN2O5. |
| Q: What is the LogP of N-butyl(o-amino)phenol? |
| A: LogP of N-butyl(o-amino)phenol is 2.24150. |
| Q: What are the downstream products of N-butyl(o-amino)phenol? |
| A: Related downstream products(CAS) of N-butyl(o-amino)phenol: 363-37-1;154-08-5. |
| Q: What is the CAS number of N-butyl(o-amino)phenol? |
| A: CAS number of N-butyl(o-amino)phenol is 428-79-5. |
| Q: What is the InChIKey of N-butyl(o-amino)phenol? |
| A: InChIKey of N-butyl(o-amino)phenol is UWEOXZHLNHALLB-UHFFFAOYSA-N. |