WAY-380153 structure
|
Common Name | WAY-380153 | ||
|---|---|---|---|---|
| CAS Number | 363160-12-7 | Molecular Weight | 271.76306 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 438.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H14ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.0±28.7 °C | |
Use of WAY-380153FKBP12 Inhibitors |
| Name | WAY-380153 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.5±45.0 °C at 760 mmHg |
| Molecular Formula | C12H14ClNO2S |
| Molecular Weight | 271.76306 |
| Flash Point | 219.0±28.7 °C |
| Exact Mass | 271.043365 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | DCTFZTBAZMXMFI-UHFFFAOYSA-N |
| SMILES | O=C(CSc1ccc(Cl)cc1)N1CCOCC1 |
| 2-[(4-Chlorophenyl)sulfanyl]-1-(4-morpholinyl)ethanone |
| Ethanone, 2-[(4-chlorophenyl)thio]-1-(4-morpholinyl)- |
| 2-[(4-chlorophenyl)sulfanyl]-1-(morpholin-4-yl)ethanone |
| MFCD01224831 |