Benzenebutanoic acid, g-oxo-4-phenoxy
Modify Date: 2025-08-20 18:56:13
Benzenebutanoic acid, g-oxo-4-phenoxy structure
|
Common Name | Benzenebutanoic acid, g-oxo-4-phenoxy | ||
|---|---|---|---|---|
| CAS Number | 36330-86-6 | Molecular Weight | 270.28000 | |
| Density | 1.233g/cm3 | Boiling Point | 476.6ºC at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4ºC | |
| Name | 4-oxo-4-(4-phenoxyphenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 476.6ºC at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28000 |
| Flash Point | 179.4ºC |
| Exact Mass | 270.08900 |
| PSA | 63.60000 |
| LogP | 3.52640 |
| Index of Refraction | 1.585 |
| InChIKey | MXDIUFKCBZTRIM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:108-30-5
CAS#:101-84-8
CAS#:67795-56-6| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 4-Oxo-4-(4-phenoxy-phenyl)-buttersaeure |
| 3-(4-phenoxybenzoyl)propionic acid |
| 4-(4-phenoxyphenyl)-4-oxobutyrate |
| benzenebutanoic acid,|A-oxo-4-phenoxy |
| 4-OXO-4-(4-PHENOXYPHENYL)BUTYRIC ACID |