N-Tosylaziridine structure
|
Common Name | N-Tosylaziridine | ||
|---|---|---|---|---|
| CAS Number | 3634-89-7 | Molecular Weight | 197.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO2S | Melting Point | 63 - 65°C (lit.) | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-Tosylaziridine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 63 - 65°C (lit.) |
|---|---|
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.25400 |
| Exact Mass | 197.05100 |
| PSA | 45.53000 |
| LogP | 2.01800 |
| InChIKey | VBNWSEVVMYMVLC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2CC2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Anet, F.A.L.,et. al.
J. Am. Chem. Soc. 89 , 357, (1967)
|
|
|
Garcia-Espana, E., et. al.
Gazz. Chim. Ital. 115 , 399, (1985)
|
| 1-(P-TOSYL)AZIRIDINE |
| 1-(4-methylphenyl)sulfonylaziridine |