3-[Dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate structure
|
Common Name | 3-[Dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 3637-26-1 | Molecular Weight | 279.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21NO5S | Melting Point | 150-155ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-[Dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]azaniumyl]propane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 150-155ºC |
|---|---|
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.35300 |
| Exact Mass | 279.11400 |
| PSA | 91.88000 |
| LogP | 1.19820 |
| InChIKey | BCAIDFOKQCVACE-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC[N+](C)(C)CCCS(=O)(=O)[O-] |
| Storage condition | Store below +30°C. |
| Water Solubility | 500g/l |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R21/22 |
| Safety Phrases | S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29239000 |
|
Compact test apparatus for evaluation of flow erosion of marine coatings.
Rev. Sci. Instrum. 86 , 105115, (2015) An apparatus designed and manufactured for evaluation of flow erosion of coatings or layers is presented in this paper. The setup was primarily designed for coatings intended to perform in dynamic mar... |
| dimethyl{2-[(2-methyl-1-oxoallyl)oxy]ethyl}(3-sulfopropyl)ammonium hydroxide |
| N-(3-Sulfopropyl)-N-(methacryloxyethyl)-N,N-dimethylammonium betaine |
| 3-(N,N-dimethyl-N-(2-methacryloxyethyl) amomonium)propylsulphonic acid |
| [2-(Methacryloyloxy)ethyl]dimethyl-(3-sulfopropyl)ammonium hydroxide |
| N-(3-sulfopropyl)-N-methacroyloxyethyl-N,N-dimethylammonium betaine |
| N,N-dimethyl-N-(2-methacryloyloxyethyl)-N-(3-sulfopropyl)ammonium betaine |
| 2-(N-3-Sulfopropyl-N,N-dimethyl ammonium)ethyl methacrylate |
| EINECS 222-860-8 |
| MFCD00040574 |
| N,N-dimethyl-N-methacryloyloxyethyl-N-(3-sulfopropyl)ammonium betaine |
| SPE |