4'-Butoxybenzylidene-4-cyanoaniline
Modify Date: 2025-09-23 18:59:59
4'-Butoxybenzylidene-4-cyanoaniline structure
|
Common Name | 4'-Butoxybenzylidene-4-cyanoaniline | ||
|---|---|---|---|---|
| CAS Number | 36405-17-1 | Molecular Weight | 278.34800 | |
| Density | 1.02g/cm3 | Boiling Point | 451.7ºC at 760mmHg | |
| Molecular Formula | C18H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227ºC | |
| Name | 4'-Butoxybenzylidene-4-cyanoaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 451.7ºC at 760mmHg |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.34800 |
| Flash Point | 227ºC |
| Exact Mass | 278.14200 |
| PSA | 45.38000 |
| LogP | 4.48778 |
| Index of Refraction | 1.548 |
| InChIKey | JWLPZJPDDBBWQD-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C=Nc2ccc(C#N)cc2)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2926909090 |
|
~%
4'-Butoxybenzyl... CAS#:36405-17-1 |
| Literature: Molecular crystals and liquid crystals, , vol. 74, # 1-4 p. 227 - 242 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-[(4-butoxyphenyl)methylideneamino]benzonitrile |
| 4-(4-Butoxybenzylideneamino)benzonitrile |
| EINECS 253-018-8 |