3-(2-cyclohexylideneethyl)-4-hydroxy-naphthalene-1,2-dione structure
|
Common Name | 3-(2-cyclohexylideneethyl)-4-hydroxy-naphthalene-1,2-dione | ||
|---|---|---|---|---|
| CAS Number | 36417-21-7 | Molecular Weight | 282.33400 | |
| Density | 1.311g/cm3 | Boiling Point | 462.2ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.5ºC | |
| Name | 3-(2-cyclohexylideneethyl)-4-hydroxynaphthalene-1,2-dione |
|---|
| Density | 1.311g/cm3 |
|---|---|
| Boiling Point | 462.2ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 247.5ºC |
| Exact Mass | 282.12600 |
| PSA | 54.37000 |
| LogP | 4.15830 |
| Index of Refraction | 1.677 |
| InChIKey | WCAKCFMWFQIPBO-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2ccccc2C(O)=C1CC=C1CCCCC1 |
|
~%
3-(2-cyclohexyl... CAS#:36417-21-7 |
| Literature: Schaffner-Sabba, Karl; Schmidt-Ruppin, Karl H.; Wehrli, Walter; Schuerch, ALfred R.; Wasley, Jan W. F. Journal of Medicinal Chemistry, 1984 , vol. 27, # 8 p. 990 - 994 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |