Z-β-Ala-ONp structure
|
Common Name | Z-β-Ala-ONp | ||
|---|---|---|---|---|
| CAS Number | 3642-91-9 | Molecular Weight | 344.31900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | (4-nitrophenyl) 3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16N2O6 |
|---|---|
| Molecular Weight | 344.31900 |
| Exact Mass | 344.10100 |
| PSA | 110.45000 |
| LogP | 3.59210 |
| InChIKey | ZVWBGQBOHVVMEB-UHFFFAOYSA-N |
| SMILES | O=C(CCNC(=O)OCc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335-H400 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2924299090 |
|
~%
Z-β-Ala-ONp CAS#:3642-91-9 |
| Literature: Flouret; Cole; Biemacher Journal of medicinal chemistry, 1972 , vol. 15, # 12 p. 1281 - 1283 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Z-|A-Ala-ONp |
| Z-|A-alanine 4-nitrophenyl ester |
| 3-<(benzyloxycarbonyl)amino>propionic acid 4-nitrophenyl ester |
| p-nitrophenyl ester of N-(benzyloxycarbonyl)-3-aminopropionic acid |
| Z-β-Ala-ONp |