2-[(ethoxycarbonimidoyl)methyl]isoindole-1,3-dione structure
|
Common Name | 2-[(ethoxycarbonimidoyl)methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 3644-69-7 | Molecular Weight | 268.69600 | |
| Density | 1.31g/cm3 | Boiling Point | 338.8ºC at 760 mmHg | |
| Molecular Formula | C12H13ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.7ºC | |
| Name | ethyl 2-(1,3-dioxoisoindol-2-yl)ethanimidate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 338.8ºC at 760 mmHg |
| Molecular Formula | C12H13ClN2O3 |
| Molecular Weight | 268.69600 |
| Flash Point | 158.7ºC |
| Exact Mass | 268.06100 |
| PSA | 70.46000 |
| LogP | 2.13600 |
| Index of Refraction | 1.613 |
| InChIKey | OGHSLILUWDJNJA-UHFFFAOYSA-N |
| SMILES | CCOC(=N)CN1C(=O)c2ccccc2C1=O.Cl |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Phthalimido-acetimidsaeure-aethylester,Hydrochloride |
| ethyl 2-(1,3-dioxoisoindol-2-yl)ethanimidate, hydrochloride |
| 2-phthalimido-acetimidic acid ethyl ester,hydrochloride |