WAY-308264 structure
|
Common Name | WAY-308264 | ||
|---|---|---|---|---|
| CAS Number | 364624-08-8 | Molecular Weight | 302.35156 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 668.3±65.0 °C at 760 mmHg | |
| Molecular Formula | C14H14N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.0±34.3 °C | |
Use of WAY-308264compounds targeting histone acetyltransferase Rtt109 |
| Name | WAY-308264 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 668.3±65.0 °C at 760 mmHg |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.35156 |
| Flash Point | 358.0±34.3 °C |
| Exact Mass | 302.083740 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | ZFKWFHMKVZEDEN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(N2C(=O)CC(Sc3ncn[nH]3)C2=O)c1 |
| 1-(3,5-dimethylphenyl)-3-(1H-1,2,4-triazol-5-ylthio)pyrrolidine-2,5-dione |
| 2,5-Pyrrolidinedione, 1-(3,5-dimethylphenyl)-3-(1H-1,2,4-triazol-5-ylthio)- |
| 1-(3,5-Dimethylphenyl)-3-(1H-1,2,4-triazol-5-ylsulfanyl)-2,5-pyrrolidinedione |
| 1-(3,5-dimethylphenyl)-3-(4H-1,2,4-triazol-3-ylsulfanyl)pyrrolidine-2,5-dione |
| 2,5-Pyrrolidinedione, 1-(3,5-dimethylphenyl)-3-(4H-1,2,4-triazol-3-ylthio)- |