fluoro-1,3-dimethyloadamantane structure
|
Common Name | fluoro-1,3-dimethyloadamantane | ||
|---|---|---|---|---|
| CAS Number | 36481-20-6 | Molecular Weight | 524.09600 | |
| Density | 1.89g/cm3 | Boiling Point | 129ºC at 760mmHg | |
| Molecular Formula | C12F20 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 44.6ºC | |
| Name | perfluoro-1,3-dimethyladamantane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.89g/cm3 |
|---|---|
| Boiling Point | 129ºC at 760mmHg |
| Molecular Formula | C12F20 |
| Molecular Weight | 524.09600 |
| Flash Point | 44.6ºC |
| Exact Mass | 523.96800 |
| LogP | 6.35300 |
| Index of Refraction | 1.315 |
| InChIKey | LRMQIJUOLGKFKS-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C12C(F)(F)C3(F)C(F)(F)C(F)(C1(F)F)C(F)(F)C(C(F)(F)F)(C3(F)F)C2(F)F |
| HS Code | 2903890090 |
|---|
|
~%
fluoro-1,3-dime... CAS#:36481-20-6 |
| Literature: Moore,R.E.; Driscoll,G.L. Journal of Organic Chemistry, 1978 , vol. 43, p. 4978 - 4980 |
|
~%
fluoro-1,3-dime... CAS#:36481-20-6 |
| Literature: Robertson,G. et al. Journal of Organic Chemistry, 1978 , vol. 43, # 26 p. 4981 - 4983 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| decafluoro-1,2-bis-trifluoromethyl-cyclohexane |
| Perfluor-1,2-dimethyl-cyclohexan |
| 1,2-bis(trifluoromethyl)decafluorocyclohexane |
| 1,2,2,3,4,4,6,6,8,8,9,9,10,10-tetradecafluoro-5,7-bis(trifluoromethyl)adamantane |
| Perfluoro-1,2-dimethylcyclohexane |
| Perfluor-1.3-dimethyladamantan |
| perfluoro-1,3-dimethyl adamantane |
| Decafluor-1,2-bis-trifluormethyl-cyclohexan |