2-Fluoro-1,3-dimethyl-5-nitrobenzene structure
|
Common Name | 2-Fluoro-1,3-dimethyl-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1736-85-2 | Molecular Weight | 169.15300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Fluoro-1,3-dimethyl-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8FNO2 |
|---|---|
| Molecular Weight | 169.15300 |
| Exact Mass | 169.05400 |
| PSA | 45.82000 |
| LogP | 2.87390 |
| InChIKey | VJEBIHTVWPSCEM-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
|
~16%
2-Fluoro-1,3-di... CAS#:1736-85-2 |
| Literature: Chemical Communications, , vol. 49, # 21 p. 2151 - 2153 |
|
~%
2-Fluoro-1,3-di... CAS#:1736-85-2 |
| Literature: Chemical Communications, , vol. 49, # 21 p. 2151 - 2153 |
|
~%
2-Fluoro-1,3-di... CAS#:1736-85-2 |
| Literature: Journal of the Chemical Society, , p. 5554 - 5556 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-fluoro-3,5-dimethylnitrobenzene |
| 3,5-dimethyl-4-fluoro-1-nitrobenzene |
| 1-fluoro-2,6-dimethyl-4-nitrobenzene |
| 3,5-dimethyl-4-fluoronitrobenzene |
| Benzene,2-fluoro-1,3-dimethyl-5-nitro |
| 2-Fluor-5-nitro-1,3-dimethyl-benzol |
| 2.6-Dimethyl-4-nitrofluorbenzol |