hexestrol dibutyrate structure
|
Common Name | hexestrol dibutyrate | ||
|---|---|---|---|---|
| CAS Number | 36557-18-3 | Molecular Weight | 410.54600 | |
| Density | 1.047g/cm3 | Boiling Point | 494.5ºC at 760 mmHg | |
| Molecular Formula | C26H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.5ºC | |
| Name | [4-[4-(4-butanoyloxyphenyl)hexan-3-yl]phenyl] butanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 494.5ºC at 760 mmHg |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.54600 |
| Flash Point | 237.5ºC |
| Exact Mass | 410.24600 |
| PSA | 52.60000 |
| LogP | 6.78500 |
| Index of Refraction | 1.524 |
| InChIKey | JTBPVVVYALFNNO-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Oc1ccc(C(CC)C(CC)c2ccc(OC(=O)CCC)cc2)cc1 |
| HS Code | 2917399090 |
|---|
|
~%
hexestrol dibutyrate CAS#:36557-18-3 |
| Literature: Foreman; Miller Journal of the American Chemical Society, 1941 , vol. 63, p. 2240 |
|
~%
hexestrol dibutyrate CAS#:36557-18-3 |
| Literature: Foreman; Miller Journal of the American Chemical Society, 1941 , vol. 63, p. 2240 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hexane-3,4-diyldibenzene-4,1-diyl dibutanoate |
| EINECS 253-102-4 |
| 3,4-bis-(4-butyryloxy-phenyl)-hexane |
| Hexestrol dibutyrate |
| 3,4-Bis-(4-butyryloxy-phenyl)-hexan |