5-Nonanone, (2,4-dinitrophenyl)hydrazone structure
|
Common Name | 5-Nonanone, (2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 3657-08-7 | Molecular Weight | 322.36000 | |
| Density | 1.22g/cm3 | Boiling Point | 443ºC at 760 mmHg | |
| Molecular Formula | C15H22N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
| Name | 5-Nonanone 2,4-dinitrophenyl hydrazone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 443ºC at 760 mmHg |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.36000 |
| Flash Point | 221.7ºC |
| Exact Mass | 322.16400 |
| PSA | 116.03000 |
| LogP | 5.77070 |
| Index of Refraction | 1.566 |
| InChIKey | ZCYIGAIUDNMPME-UHFFFAOYSA-N |
| SMILES | CCCCC(CCCC)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Nonan-5-on-o,p-dinitrophenylhydrazon |
| Nonanon-5-<2.4-dinitro-phenylhydrazon> |