4-Nitroisoindolin-1-one structure
|
Common Name | 4-Nitroisoindolin-1-one | ||
|---|---|---|---|---|
| CAS Number | 366452-97-3 | Molecular Weight | 178.14500 | |
| Density | 1.45g/cm3 | Boiling Point | 488.773ºC at 760 mmHg | |
| Molecular Formula | C8H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.401ºC | |
| Name | 4-Nitroisoindolin-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 488.773ºC at 760 mmHg |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.14500 |
| Flash Point | 249.401ºC |
| Exact Mass | 178.03800 |
| PSA | 74.92000 |
| LogP | 1.69020 |
| Index of Refraction | 1.632 |
| InChIKey | RTDDSWLIZLMORY-UHFFFAOYSA-N |
| SMILES | O=C1NCc2c1cccc2[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933790090 |
|
~88%
4-Nitroisoindol... CAS#:366452-97-3 |
| Literature: NANJING CAVENDISH BIO-ENGINEERING TECHNOLOGY CO., LTD.; YAN, Rong; YANG, Hao; XU, Yongxiang Patent: WO2010/139266 A1, 2010 ; Location in patent: Page/Page column 37-38 ; |
|
~%
4-Nitroisoindol... CAS#:366452-97-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 14, # 1 p. 81 - 85 |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| 4-nitro-2,3-dihydroisoindol-1-one |