n-ethyl-4-nitroaniline structure
|
Common Name | n-ethyl-4-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 3665-80-3 | Molecular Weight | 166.17700 | |
| Density | 1.21g/cm3 | Boiling Point | 302.3ºC at 760mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | 96-98ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 136.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | n-ethyl-4-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 302.3ºC at 760mmHg |
| Melting Point | 96-98ºC(lit.) |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.17700 |
| Flash Point | 136.6ºC |
| Exact Mass | 166.07400 |
| PSA | 57.85000 |
| LogP | 2.62280 |
| InChIKey | XBNNLAWQCMDISJ-UHFFFAOYSA-N |
| SMILES | CCNc1ccc([N+](=O)[O-])cc1 |
| Stability | Stable, but may be air sensitive. Incompatible with strong oxidizing agents, strong bases. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921499090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Second-Order Nonlinearity of Mixtures Including p-Nitroaniline Derivatives. Kato M, et al.
J. Phys. Chem. B 101(44) , 8856-59, (1997)
|
| N-ethyl-4-nitrobenzenamine |
| Benzenamine,N-ethyl-4-nitro |
| p-nitro-phenyl-ethylamine |
| 4-nitro-N-ethylaniline |
| MFCD00010647 |
| N1-ethyl-4-nitroaniline |
| EINECS 222-927-1 |