2,4-Bis(trifluoromethyl)aniline structure
|
Common Name | 2,4-Bis(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 367-71-5 | Molecular Weight | 229.122 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 175.1±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5F6N | Melting Point | N/A | |
| MSDS | USA | Flash Point | 69.8±18.0 °C | |
| Name | 2,4-Bis(Trifluoromethyl)Aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 175.1±40.0 °C at 760 mmHg |
| Molecular Formula | C8H5F6N |
| Molecular Weight | 229.122 |
| Flash Point | 69.8±18.0 °C |
| Exact Mass | 229.032623 |
| PSA | 26.02000 |
| LogP | 3.70 |
| Vapour Pressure | 1.2±0.3 mmHg at 25°C |
| Index of Refraction | 1.423 |
| InChIKey | UIWVOUBVGBJRNP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(F)(F)F |
| Hazard Codes | T: Toxic; |
|---|---|
| Risk Phrases | R23/24/25 |
| Safety Phrases | S36/37/39-S45 |
| RIDADR | 2810 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,4-Bis(trifluoromethyl)benzenamine |
| 2,4-Bis(trifluoromethyl)aniline |
| FXFFR BZ EXFFF |
| 2,4-Ditrifluoromethylaniline |
| MFCD00236209 |