BOC-D-Phe-OSU structure
|
Common Name | BOC-D-Phe-OSU | ||
|---|---|---|---|---|
| CAS Number | 3674-18-8 | Molecular Weight | 362.377 | |
| Density | 1.28±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H22N2O6 | Melting Point | 152-153 ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of BOC-D-Phe-OSU(R)-2,5-Ddioxopyrrolidin-1-yl 2-((tert-butoxycarbonyl)amino)-3-phenylpropanoate is a phenylalanine derivative[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Description | (R)-2,5-Ddioxopyrrolidin-1-yl 2-((tert-butoxycarbonyl)amino)-3-phenylpropanoate is a phenylalanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.28±0.1 g/cm3 |
|---|---|
| Melting Point | 152-153 ºC |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.377 |
| Exact Mass | 362.147797 |
| PSA | 102.01000 |
| LogP | 1.51 |
| Index of Refraction | 1.562 |
| InChIKey | NHUCANAMPJGMQL-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)ON1C(=O)CCC1=O |
| Storage condition | −20°C |
| Water Solubility | Very slightly soluble (0.33 g/L) (25 ºC) |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00069688 |
| Boc-D-pheO-succinyl |
| N-Boc-D-Phe-Osu |
| N-tert-butoxycarbonyl-D-phenylalanine hydroxysuccinimide ester |
| N-boc-D-phe-O-succinimide |
| Boc-D-phenylalanine N-hydroxysuccinimide ester |
| tert-Butyloxycarbonyl-D-phenylalanine N-hydroxysuccinimide ester |
| N-tertiarybutoxycarbonyl-D-phenylalanine N-hydroxysuccinimide ester |
| 2,5-Dioxo-1-pyrrolidinyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalaninate |
| Boc-D-Phe-OSu |
| Boc-D-Phe-N-hydroxy-succinimidester |
| D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-, 2,5-dioxo-1-pyrrolidinyl ester |
| Boc-D-phenylalanine N-hydroxy succinimide ester |
| N-Boc-D-phenylalanine N-hydroxysucciniMide ester |