2-methyl-1,1-diphenyl-propan-2-ol
Modify Date: 2025-10-18 18:07:39
2-methyl-1,1-diphenyl-propan-2-ol structure
|
Common Name | 2-methyl-1,1-diphenyl-propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 3677-76-7 | Molecular Weight | 226.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-1,1-diphenyl-propan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H18O |
|---|---|
| Molecular Weight | 226.31400 |
| Exact Mass | 226.13600 |
| PSA | 20.23000 |
| LogP | 3.58940 |
| InChIKey | IGTUUFWQCPWFCF-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(c1ccccc1)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:60227-39-6
CAS#:5344-64-9This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: InChIKey of 2-methyl-1,1-diphenyl-propan-2-ol is IGTUUFWQCPWFCF-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: Related downstream products(CAS) of 2-methyl-1,1-diphenyl-propan-2-ol: 60227-39-6;5344-64-9. |
| Q: What is the LogP of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: LogP of 2-methyl-1,1-diphenyl-propan-2-ol is 3.58940. |
| Q: What is the English name of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: The English name of 2-methyl-1,1-diphenyl-propan-2-ol is 2-methyl-1,1-diphenyl-propan-2-ol. |
| Q: What is the polar surface area (PSA) of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: Polar surface area (PSA) of 2-methyl-1,1-diphenyl-propan-2-ol is 20.23000. |
| Q: What is the CAS number of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: CAS number of 2-methyl-1,1-diphenyl-propan-2-ol is 3677-76-7. |
| Q: What is the Chinese name of 3677-76-7? |
| A: Chinese name of 3677-76-7 is 3677-76-7. |
| Q: What is the molecular weight of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: Molecular weight of 2-methyl-1,1-diphenyl-propan-2-ol is 226.31400. |
| Q: What is the SMILES notation of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: SMILES notation of 2-methyl-1,1-diphenyl-propan-2-ol is CC(C)(O)C(c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of 2-methyl-1,1-diphenyl-propan-2-ol? |
| A: Molecular formula of 2-methyl-1,1-diphenyl-propan-2-ol is C16H18O. |