2-methyl-1,1-diphenyl-propane-1,2-diol structure
|
Common Name | 2-methyl-1,1-diphenyl-propane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 5344-64-9 | Molecular Weight | 242.31300 | |
| Density | 1.13g/cm3 | Boiling Point | 411.3ºC at 760 mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
| Name | 2-methyl-1,1-diphenylpropane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 411.3ºC at 760 mmHg |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 195ºC |
| Exact Mass | 242.13100 |
| PSA | 40.46000 |
| LogP | 2.69340 |
| Index of Refraction | 1.587 |
| InChIKey | NEBPKRZOOBQYIN-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(O)(c1ccccc1)c1ccccc1 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 1,2-Dihydroxy-2-methyl-1,1-diphenyl-propan |
| asymmetrical pinacol |
| 2-Methyl-1,1-diphenyl-propan-1,2-diol |
| 2-methyl-1,1-diphenyl-propane-1,2-diol |