2-methyl-1,1-diphenyl-propane-1,2-diol
2-methyl-1,1-diphenyl-propane-1,2-diol structure
|
Common Name | 2-methyl-1,1-diphenyl-propane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 5344-64-9 | Molecular Weight | 242.31300 | |
| Density | 1.13g/cm3 | Boiling Point | 411.3ºC at 760 mmHg | |
| Molecular Formula | C16H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-methyl-1,1-diphenylpropane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 411.3ºC at 760 mmHg |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.31300 |
| Flash Point | 195ºC |
| Exact Mass | 242.13100 |
| PSA | 40.46000 |
| LogP | 2.69340 |
| Index of Refraction | 1.587 |
| InChIKey | NEBPKRZOOBQYIN-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C(O)(c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 3 | |
CAS#:201230-82-2
CAS#:67-64-1
CAS#:464-72-2
CAS#:119-61-9
CAS#:3677-76-7
CAS#:100-58-3
CAS#:611-70-1
CAS#:781-33-9
CAS#:111-13-7
CAS#:781-35-1
CAS#:91-01-0
CAS#:13740-70-0This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,2-Dihydroxy-2-methyl-1,1-diphenyl-propan |
| asymmetrical pinacol |
| 2-Methyl-1,1-diphenyl-propan-1,2-diol |
| 2-methyl-1,1-diphenyl-propane-1,2-diol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: SMILES notation of 2-methyl-1,1-diphenylpropane-1,2-diol is CC(C)(O)C(O)(c1ccccc1)c1ccccc1. |
| Q: What is the molecular formula of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: Molecular formula of 2-methyl-1,1-diphenylpropane-1,2-diol is C16H18O2. |
| Q: What is the Chinese name of 5344-64-9? |
| A: Chinese name of 5344-64-9 is 5344-64-9. |
| Q: What English synonyms does 2-methyl-1,1-diphenylpropane-1,2-diol have? |
| A: English synonyms of 2-methyl-1,1-diphenylpropane-1,2-diol: 1,2-Dihydroxy-2-methyl-1,1-diphenyl-propan, asymmetrical pinacol, 2-Methyl-1,1-diphenyl-propan-1,2-diol, 2-methyl-1,1-diphenyl-propane-1,2-diol. |
| Q: What is the polar surface area (PSA) of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: Polar surface area (PSA) of 2-methyl-1,1-diphenylpropane-1,2-diol is 40.46000. |
| Q: What is the LogP of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: LogP of 2-methyl-1,1-diphenylpropane-1,2-diol is 2.69340. |
| Q: What is the molecular weight of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: Molecular weight of 2-methyl-1,1-diphenylpropane-1,2-diol is 242.31300. |
| Q: What is the CAS number of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: CAS number of 2-methyl-1,1-diphenylpropane-1,2-diol is 5344-64-9. |
| Q: What are the downstream products of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: Related downstream products(CAS) of 2-methyl-1,1-diphenylpropane-1,2-diol: 119-61-9;91-01-0;13740-70-0. |
| Q: What is the boiling point of 2-methyl-1,1-diphenylpropane-1,2-diol? |
| A: Boiling point of 2-methyl-1,1-diphenylpropane-1,2-diol is 411.3ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |