N-Methyl-N-(3-chloropropyl)-3,4-dimethoxy benzenethylamine structure
|
Common Name | N-Methyl-N-(3-chloropropyl)-3,4-dimethoxy benzenethylamine | ||
|---|---|---|---|---|
| CAS Number | 36770-74-8 | Molecular Weight | 271.78300 | |
| Density | 1.066g/cm3 | Boiling Point | 361.8ºC at 760mmHg | |
| Molecular Formula | C14H22ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.6ºC | |
| Name | N-Methyl-N-(3-chloropropyl)-3,4-dimethoxyphenethylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.066g/cm3 |
|---|---|
| Boiling Point | 361.8ºC at 760mmHg |
| Molecular Formula | C14H22ClNO2 |
| Molecular Weight | 271.78300 |
| Flash Point | 172.6ºC |
| Exact Mass | 271.13400 |
| PSA | 21.70000 |
| LogP | 2.80700 |
| Index of Refraction | 1.51 |
| InChIKey | HJBBKVHYQQUPQW-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCN(C)CCCCl)cc1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922299090 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD08063812 |