Salifungin structure
|
Common Name | Salifungin | ||
|---|---|---|---|---|
| CAS Number | 3679-64-9 | Molecular Weight | 326.57300 | |
| Density | 1.675g/cm3 | Boiling Point | 372.8ºC at 760mmHg | |
| Molecular Formula | C13H9BrClNO2 | Melting Point | 246ºC | |
| MSDS | N/A | Flash Point | 179.3ºC | |
Use of SalifunginMultifungin (Bromochlorosalicylanilide) is an antifungal that treats oral candidiasis[1]. Multifungin prevents the formation and accumulation of Zearalenone and reduces the fungal population in stored-crushed corn[2]. |
| Name | 5-bromo-N-(4-chlorophenyl)-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Multifungin (Bromochlorosalicylanilide) is an antifungal that treats oral candidiasis[1]. Multifungin prevents the formation and accumulation of Zearalenone and reduces the fungal population in stored-crushed corn[2]. |
|---|---|
| Related Catalog | |
| Target |
candidiasis[1] |
| References |
| Density | 1.675g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760mmHg |
| Melting Point | 246ºC |
| Molecular Formula | C13H9BrClNO2 |
| Molecular Weight | 326.57300 |
| Flash Point | 179.3ºC |
| Exact Mass | 324.95100 |
| PSA | 49.33000 |
| LogP | 4.13340 |
| Index of Refraction | 1.699 |
| InChIKey | QBSGXIBYUQJHMJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Salifungen |
| 5-Bromosalicyl-4-chloroanilide |
| Bromosalicylchloranilide |
| Salifungin |
| 5-Bromosalicyl-4'-chloranilid |
| 5-BroMo-4'-chlorosalicylanilide |
| n-5-bromosalicyloyl-p-chloroaniline |
| EINECS 222-957-5 |
| 5-Bromo-4'-chloro-2-hydroxybenzanilide |
| 4'-chloro-5-bromo salicylanilide |