Salifungin structure
|
Common Name | Salifungin | ||
|---|---|---|---|---|
| CAS Number | 3679-64-9 | Molecular Weight | 326.57300 | |
| Density | 1.675g/cm3 | Boiling Point | 372.8ºC at 760mmHg | |
| Molecular Formula | C13H9BrClNO2 | Melting Point | 246ºC | |
| MSDS | N/A | Flash Point | 179.3ºC | |
Use of SalifunginMultifungin (Bromochlorosalicylanilide) is an antifungal that treats oral candidiasis[1]. Multifungin prevents the formation and accumulation of Zearalenone and reduces the fungal population in stored-crushed corn[2]. |
| Name | 5-bromo-N-(4-chlorophenyl)-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Multifungin (Bromochlorosalicylanilide) is an antifungal that treats oral candidiasis[1]. Multifungin prevents the formation and accumulation of Zearalenone and reduces the fungal population in stored-crushed corn[2]. |
|---|---|
| Related Catalog | |
| Target |
candidiasis[1] |
| References |
| Density | 1.675g/cm3 |
|---|---|
| Boiling Point | 372.8ºC at 760mmHg |
| Melting Point | 246ºC |
| Molecular Formula | C13H9BrClNO2 |
| Molecular Weight | 326.57300 |
| Flash Point | 179.3ºC |
| Exact Mass | 324.95100 |
| PSA | 49.33000 |
| LogP | 4.13340 |
| Index of Refraction | 1.699 |
| InChIKey | QBSGXIBYUQJHMJ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc(Br)ccc1O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Inhibition of recombinant Cryptosporidium hominis TS-DHFR expressed in Escherichia co...
Source: ChEMBL
Target: Bifunctional dihydrofolate reductase-thymidylate synthase
External Id: CHEMBL4392309
|
|
Name: Beta-blocking activity was measured by applying the stepwise linear discriminate anal...
Source: ChEMBL
Target: Beta-1 adrenergic receptor
External Id: CHEMBL650217
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| Salifungen |
| 5-Bromosalicyl-4-chloroanilide |
| Bromosalicylchloranilide |
| Salifungin |
| 5-Bromosalicyl-4'-chloranilid |
| 5-BroMo-4'-chlorosalicylanilide |
| n-5-bromosalicyloyl-p-chloroaniline |
| EINECS 222-957-5 |
| 5-Bromo-4'-chloro-2-hydroxybenzanilide |
| 4'-chloro-5-bromo salicylanilide |