7-Nitro-4H-isochromene-1,3-dione structure
|
Common Name | 7-Nitro-4H-isochromene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 36795-25-2 | Molecular Weight | 207.140 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 424.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C9H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4±30.7 °C | |
| Name | 7-nitro-4H-isochromene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.1±45.0 °C at 760 mmHg |
| Molecular Formula | C9H5NO5 |
| Molecular Weight | 207.140 |
| Flash Point | 225.4±30.7 °C |
| Exact Mass | 207.016769 |
| PSA | 89.19000 |
| LogP | 0.14 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | BGASVHXIJWUJNM-UHFFFAOYSA-N |
| SMILES | O=C1Cc2ccc([N+](=O)[O-])cc2C(=O)O1 |
|
~88%
7-Nitro-4H-isoc... CAS#:36795-25-2 |
| Literature: KATHOLIEKE UNIVERSITEIT LEUVEN, K.U.LEUVEN Randamp;D; BARDIOT, Dorothee; BLANCHE, Emilie; CHALTIN, Patrick; KOUKNI, Mohamed; LEYSSEN, Pieter; NEYTS, Johan; MARCHAND, Arnaud; VLIEGEN, Inge Patent: WO2010/55164 A2, 2010 ; Location in patent: Page/Page column 135 ; |
|
~%
7-Nitro-4H-isoc... CAS#:36795-25-2 |
| Literature: THE PROVOST, FELLOWS, FOUNDATION SCHOLARS, AND THE OTHER MEMBERS OF BOARD; Connon, Stephen J.; Tallon, Sean; Cornaggia, Claudio; Manoni, Francesco; Torrente, Esther Patent: US2013/245268 A1, 2013 ; Location in patent: Page/Page column ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-nitrohomophthalic acid anhydride |
| (2-Carboxy-4-nitro-phenyl)-essigsaeure-anhydrid |
| (2-carboxy-4-nitro-phenyl)-acetic acid-anhydride |
| 1H-2-Benzopyran-1,3(4H)-dione,7-nitro |
| 7-Nitro-1H-isochromene-1,3(4H)-dione |
| 5-nitrohomophthalic anhydride |
| 4-nitrohomophthalic anhydride |
| 7-nitro-isochroman-1,3-dione |