(1,3-dimethylbutylidene)bis[tert-butyl] peroxide
Modify Date: 2025-08-26 09:02:11
![(1,3-dimethylbutylidene)bis[tert-butyl] peroxide Structure](https://image.chemsrc.com/caspic/189/36799-28-7.png)
(1,3-dimethylbutylidene)bis[tert-butyl] peroxide structure
|
Common Name | (1,3-dimethylbutylidene)bis[tert-butyl] peroxide | ||
|---|---|---|---|---|
| CAS Number | 36799-28-7 | Molecular Weight | 228.37100 | |
| Density | 0.917g/cm3 | Boiling Point | 279.8ºC at 760mmHg | |
| Molecular Formula | C14H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 95.9ºC | |
| Name | 3,3,5,7,7-pentamethyl-5-(2-methylpropyl)dioxepane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.917g/cm3 |
|---|---|
| Boiling Point | 279.8ºC at 760mmHg |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.37100 |
| Flash Point | 95.9ºC |
| Exact Mass | 228.20900 |
| PSA | 18.46000 |
| LogP | 4.33800 |
| Index of Refraction | 1.429 |
| InChIKey | LRAJIZIAZYBDPU-UHFFFAOYSA-N |
| SMILES | CC(C)CC1(C)CC(C)(C)OOC(C)(C)C1 |
| HS Code | 2909600000 |
|---|
|
~41%
(1,3-dimethylbu... CAS#:36799-28-7 |
| Literature: Terent'ev, Alexander O.; Kutkin, Alexander V.; Troizky, Nikolay A.; Ogibin, Yuri N.; Nikishin, Gennady I. Synthesis, 2005 , # 13 art. no. P03005SS, p. 2215 - 2219 |
|
~%
(1,3-dimethylbu... CAS#:36799-28-7 |
| Literature: Antonovskii, V. L.; Fedorova, E. V.; Shtivel', N. E.; Emelin, Yu. D. Journal of Organic Chemistry USSR (English Translation), 1991 , vol. 27, # 4 p. 704 - 706 Zhurnal Organicheskoi Khimii, 1991 , vol. 27, # 4 p. 820 - 823 |
| HS Code | 2909600000 |
|---|---|
| Summary | 2909600000 alcohol peroxides, ether peroxides, ketone peroxides and their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-Methyl-2,2-bis-tert-butylperoxy-pentan |
| 2,2-bis(tert-butylperoxy)-4-methylpentane |
| 4.4-Di-tert.-butylperoxy-2-methyl-pentan |
| 4-methyl-2,2-bis-tert-butylperoxy-pentane |
| EINECS 253-221-1 |
| (1,3-Dimethylbutylidene)bis(tert-butyl) peroxide |