3-[6-(3-carboxyprop-2-enoylamino)hexylcarbamoyl]prop-2-enoic acid structure
|
Common Name | 3-[6-(3-carboxyprop-2-enoylamino)hexylcarbamoyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 36848-00-7 | Molecular Weight | 312.31800 | |
| Density | 1.259g/cm3 | Boiling Point | 691.1ºC at 760 mmHg | |
| Molecular Formula | C14H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.8ºC | |
| Name | 4-[6-(3-carboxyprop-2-enoylamino)hexylamino]-4-oxobut-2-enoic acid |
|---|
| Density | 1.259g/cm3 |
|---|---|
| Boiling Point | 691.1ºC at 760 mmHg |
| Molecular Formula | C14H20N2O6 |
| Molecular Weight | 312.31800 |
| Flash Point | 371.8ºC |
| Exact Mass | 312.13200 |
| PSA | 132.80000 |
| LogP | 0.84260 |
| Index of Refraction | 1.536 |
| InChIKey | WPUBWLUSKQXZNQ-KQQUZDAGSA-N |
| SMILES | O=C(O)C=CC(=O)NCCCCCCNC(=O)C=CC(=O)O |
|
~%
3-[6-(3-carboxy... CAS#:36848-00-7 |
| Literature: Dave, Pragnesh N.; Patel, Nikul N. Journal of the Indian Chemical Society, 2011 , vol. 88, # 7 p. 953 - 958 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |