4-[(E)-2-(4-hydroxyphenyl)but-1-enyl]phenol structure
|
Common Name | 4-[(E)-2-(4-hydroxyphenyl)but-1-enyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 3691-71-2 | Molecular Weight | 240.29700 | |
| Density | 1.167g/cm3 | Boiling Point | 385.7ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.5ºC | |
| Name | 4-[(E)-2-(4-hydroxyphenyl)but-1-enyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 385.7ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 181.5ºC |
| Exact Mass | 240.11500 |
| PSA | 40.46000 |
| LogP | 4.04840 |
| Index of Refraction | 1.652 |
| InChIKey | PIEBWUHNLFOEHS-ACCUITESSA-N |
| SMILES | CCC(=Cc1ccc(O)cc1)c1ccc(O)cc1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| monoethylstilbestrol |
| Ethylstilboestrol |
| Ethylstilbestrol |