sodium,6,8-bis(sulfanyl)octanoate
sodium,6,8-bis(sulfanyl)octanoate structure
|
Common Name | sodium,6,8-bis(sulfanyl)octanoate | ||
|---|---|---|---|---|
| CAS Number | 36915-02-3 | Molecular Weight | 230.32300 | |
| Density | N/A | Boiling Point | 360.8ºC at 760 mmHg | |
| Molecular Formula | C8H15NaO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | sodium,6,8-bis(sulfanyl)octanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 360.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C8H15NaO2S2 |
| Molecular Weight | 230.32300 |
| Flash Point | 172ºC |
| Exact Mass | 230.04100 |
| PSA | 117.73000 |
| LogP | 0.91500 |
| InChIKey | NKWZDUQCHVQLPU-UHFFFAOYSA-M |
| SMILES | O=C([O-])CCCCC(S)CCS.[Na+] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
sodium,6,8-bis(... CAS#:36915-02-3 |
| Literature: Gibson, Frank S.; Gupta, Deepak; Shorr, Robert; Rodriguez, Robert Organic Process Research and Development, 2011 , vol. 15, # 4 p. 855 - 857 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:95809-78-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of sodium,6,8-bis(sulfanyl)octanoate? |
| A: The English name of sodium,6,8-bis(sulfanyl)octanoate is sodium,6,8-bis(sulfanyl)octanoate. |
| Q: What is the InChIKey of sodium,6,8-bis(sulfanyl)octanoate? |
| A: InChIKey of sodium,6,8-bis(sulfanyl)octanoate is NKWZDUQCHVQLPU-UHFFFAOYSA-M. |
| Q: What is the LogP of sodium,6,8-bis(sulfanyl)octanoate? |
| A: LogP of sodium,6,8-bis(sulfanyl)octanoate is 0.91500. |
| Q: What are the downstream products of sodium,6,8-bis(sulfanyl)octanoate? |
| A: Related downstream products(CAS) of sodium,6,8-bis(sulfanyl)octanoate: 95809-78-2. |
| Q: What are the upstream materials of sodium,6,8-bis(sulfanyl)octanoate? |
| A: Related upstream materials(CAS) of sodium,6,8-bis(sulfanyl)octanoate: 1077-28-7. |
| Q: What is the CAS number of sodium,6,8-bis(sulfanyl)octanoate? |
| A: CAS number of sodium,6,8-bis(sulfanyl)octanoate is 36915-02-3. |
| Q: What is the boiling point of sodium,6,8-bis(sulfanyl)octanoate? |
| A: Boiling point of sodium,6,8-bis(sulfanyl)octanoate is 360.8ºC at 760 mmHg. |
| Q: What is the SMILES notation of sodium,6,8-bis(sulfanyl)octanoate? |
| A: SMILES notation of sodium,6,8-bis(sulfanyl)octanoate is O=C([O-])CCCCC(S)CCS.[Na+]. |
| Q: What is the polar surface area (PSA) of sodium,6,8-bis(sulfanyl)octanoate? |
| A: Polar surface area (PSA) of sodium,6,8-bis(sulfanyl)octanoate is 117.73000. |
| Q: What is the molecular weight of sodium,6,8-bis(sulfanyl)octanoate? |
| A: Molecular weight of sodium,6,8-bis(sulfanyl)octanoate is 230.32300. |