trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane
![trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane Structure](https://image.chemsrc.com/caspic/163/369390-65-8.png)
trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane structure
|
Common Name | trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane | ||
|---|---|---|---|---|
| CAS Number | 369390-65-8 | Molecular Weight | 276.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2Si |
|---|---|
| Molecular Weight | 276.40800 |
| Exact Mass | 276.10800 |
| PSA | 25.78000 |
| LogP | 4.01190 |
| InChIKey | FOUVCAPBUVVQCC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#Cc1cnc2c(ccc3cccnc32)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~94%
trimethyl-[2-(1... CAS#:369390-65-8 |
| Literature: Schmittel; Michel; Wiegrefe; Kalsani Synthesis, 2001 , # 10 p. 1561 - 1567 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(trimethylsilyl)ethynyl-1,10-phenanthroline |
| 1,10-Phenanthroline,3-[(trimethylsilyl)ethynyl] |
| 3-Trimethylsilanylethynyl-[1,10]phenanthroline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: Related upstream materials(CAS) of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane: 66127-01-3;1066-54-2. |
| Q: What is the CAS number of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: CAS number of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is 369390-65-8. |
| Q: What is the molecular formula of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: Molecular formula of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is C17H16N2Si. |
| Q: What is the SMILES notation of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: SMILES notation of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is C[Si](C)(C)C#Cc1cnc2c(ccc3cccnc32)c1. |
| Q: What is the English name of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: The English name of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane. |
| Q: What is the LogP of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: LogP of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is 4.01190. |
| Q: What is the Chinese name of 369390-65-8? |
| A: Chinese name of 369390-65-8 is 369390-65-8. |
| Q: What English synonyms does trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane have? |
| A: English synonyms of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane: 3-(trimethylsilyl)ethynyl-1,10-phenanthroline, 1,10-Phenanthroline,3-[(trimethylsilyl)ethynyl], 3-Trimethylsilanylethynyl-[1,10]phenanthroline. |
| Q: What is the InChIKey of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: InChIKey of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is FOUVCAPBUVVQCC-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane? |
| A: Polar surface area (PSA) of trimethyl-[2-(1,10-phenanthrolin-3-yl)ethynyl]silane is 25.78000. |