N-[3-(benzenesulfonyl)-4-hydroxy-naphthalen-1-yl]benzenesulfonamide structure
|
Common Name | N-[3-(benzenesulfonyl)-4-hydroxy-naphthalen-1-yl]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 36942-40-2 | Molecular Weight | 439.50400 | |
| Density | 1.467g/cm3 | Boiling Point | 693.5ºC at 760 mmHg | |
| Molecular Formula | C22H17NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 373.2ºC | |
| Name | 1,2-benzisothiazol-3-ylpiperazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 693.5ºC at 760 mmHg |
| Molecular Formula | C22H17NO5S2 |
| Molecular Weight | 439.50400 |
| Flash Point | 373.2ºC |
| Exact Mass | 439.05500 |
| PSA | 117.30000 |
| LogP | 6.41360 |
| Index of Refraction | 1.706 |
| InChIKey | RAETULYCBKKWLM-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1cc(S(=O)(=O)c2ccccc2)c(O)c2ccccc12)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
N-[3-(benzenesu... CAS#:36942-40-2 |
| Literature: Adams; Whitaker Journal of the American Chemical Society, 1956 , vol. 78, p. 658,661 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 3-PIPERAZIN-1-YL-1,2-BENZISOTHIAZOLE |
| 3-piperazinyl-1,2-benzisothiazole |