Phosphonium, [(1,3-dihydro-1, 3-dioxo-2H-isoindol-2-yl)methyl]triphenyl-, bromide
![Phosphonium, [(1,3-dihydro-1, 3-dioxo-2H-isoindol-2-yl)methyl]triphenyl-, bromide Structure](https://image.chemsrc.com/caspic/193/36957-63-8.png)
Phosphonium, [(1,3-dihydro-1, 3-dioxo-2H-isoindol-2-yl)methyl]triphenyl-, bromide structure
|
Common Name | Phosphonium, [(1,3-dihydro-1, 3-dioxo-2H-isoindol-2-yl)methyl]triphenyl-, bromide | ||
|---|---|---|---|---|
| CAS Number | 36957-63-8 | Molecular Weight | 502.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H21BrNO2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H21BrNO2P |
|---|---|
| Molecular Weight | 502.33900 |
| Exact Mass | 501.04900 |
| PSA | 50.97000 |
| LogP | 1.17610 |
| InChIKey | LZWLMTBTZRMATC-UHFFFAOYSA-M |
| SMILES | O=C1c2ccccc2C(=O)N1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Phosphonium, [(... CAS#:36957-63-8 |
| Literature: Enzmann, Armin; Eckert, Markus; Ponikwar, Walter; Polborn, Kurt; Schneiderbauer, Stefan; Beller, Matthias; Beck, Wolfgang European Journal of Inorganic Chemistry, 2004 , # 6 p. 1330 - 1340 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-phthaloylaminomethyltriphenylphosphonium bromide |
| Phosphonium,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]triphenyl-,bromide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: LogP of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is 1.17610. |
| Q: What is the Chinese name of 36957-63-8? |
| A: Chinese name of 36957-63-8 is 36957-63-8. |
| Q: What is the InChIKey of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: InChIKey of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is LZWLMTBTZRMATC-UHFFFAOYSA-M. |
| Q: What English synonyms does (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide have? |
| A: English synonyms of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide: N-phthaloylaminomethyltriphenylphosphonium bromide, Phosphonium,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]triphenyl-,bromide. |
| Q: What is the CAS number of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: CAS number of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is 36957-63-8. |
| Q: What is the molecular weight of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: Molecular weight of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is 502.33900. |
| Q: What is the polar surface area (PSA) of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: Polar surface area (PSA) of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is 50.97000. |
| Q: What are the upstream materials of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: Related upstream materials(CAS) of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide: 5332-26-3;603-35-0. |
| Q: What is the SMILES notation of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: SMILES notation of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is O=C1c2ccccc2C(=O)N1C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]. |
| Q: What is the molecular formula of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide? |
| A: Molecular formula of (1,3-dioxoisoindol-2-yl)methyl-triphenylphosphanium,bromide is C27H21BrNO2P. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |