N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide
N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide structure
|
Common Name | N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 36965-16-9 | Molecular Weight | 340.73900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClN2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9ClN2O5S |
|---|---|
| Molecular Weight | 340.73900 |
| Exact Mass | 339.99200 |
| PSA | 117.44000 |
| LogP | 4.36180 |
| InChIKey | NOPPJNVGKXKZSN-UHFFFAOYSA-N |
| SMILES | O=C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of vascular endothelial growth factor (VEGF)-stimulated human umbilical ve...
Source: ChEMBL
Target: Vascular endothelial growth factor receptor 3
External Id: CHEMBL835746
|
|
Name: Diameter of zone of inhibition for cell colony formation of solid tumor HCT116 at the...
Source: ChEMBL
Target: HCT-116
External Id: CHEMBL826550
|
|
Name: Diameter of zone of inhibition for cell colony formation of leukemia L1210 at the dos...
Source: ChEMBL
Target: L1210
External Id: CHEMBL826531
|
|
Name: Diameter of zone of inhibition for cell colony formation of normal fibroblast at the ...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL825732
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-4-Nitrobenzoyl-4-chlorbenzolsulfonamid |
| 4-Chloro-N-(4-nitro-benzoyl)-benzenesulfonamide |
| Benzamide,N-[(4-chlorophenyl)sulfonyl]-4-nitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: Polar surface area (PSA) of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is 117.44000. |
| Q: What is the English name of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: The English name of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide. |
| Q: What is the LogP of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: LogP of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is 4.36180. |
| Q: What is the molecular formula of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: Molecular formula of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is C13H9ClN2O5S. |
| Q: What is the SMILES notation of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: SMILES notation of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is O=C(NS(=O)(=O)c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the InChIKey of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: InChIKey of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is NOPPJNVGKXKZSN-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: CAS number of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is 36965-16-9. |
| Q: What is the Chinese name of 36965-16-9? |
| A: Chinese name of 36965-16-9 is 36965-16-9. |
| Q: What English synonyms does N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide have? |
| A: English synonyms of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide: N-4-Nitrobenzoyl-4-chlorbenzolsulfonamid, 4-Chloro-N-(4-nitro-benzoyl)-benzenesulfonamide, Benzamide,N-[(4-chlorophenyl)sulfonyl]-4-nitro. |
| Q: What is the molecular weight of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide? |
| A: Molecular weight of N-(4-chlorophenyl)sulfonyl-4-nitrobenzamide is 340.73900. |