2′-Deoxyuridine-C,N2 structure
|
Common Name | 2′-Deoxyuridine-C,N2 | ||
|---|---|---|---|---|
| CAS Number | 369656-76-8 | Molecular Weight | 228.202 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2′-Deoxyuridine-C,N22'-Deoxyuridine-13C,15N2 is the 13C and 15N labeled 2'-Deoxyuridine[1]. 2'-Deoxyuridine could increase chromosome breakage and results in a decreased thymidylate synthetase activity. A known use of 2'-Deoxyuridine is as a precursor in the synthesis of Edoxudine[2]. |
| Name | 2'-Deoxyuridine-13C,15N2 |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Deoxyuridine-13C,15N2 is the 13C and 15N labeled 2'-Deoxyuridine[1]. 2'-Deoxyuridine could increase chromosome breakage and results in a decreased thymidylate synthetase activity. A known use of 2'-Deoxyuridine is as a precursor in the synthesis of Edoxudine[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O5 |
| Molecular Weight | 228.202 |
| Exact Mass | 228.074615 |
| PSA | 104.55000 |
| LogP | -1.70 |
| Index of Refraction | 1.603 |
| InChIKey | MXHRCPNRJAMMIM-BRNXEOTRSA-N |
| SMILES | O=c1ccn(C2CC(O)C(CO)O2)c(=O)[nH]1 |
| Storage condition | -20°C |
| 1-(2-Deoxy-β-D-threo-pentofuranosyl)-2,4(1H,3H)-pyrimidinedione |
| 1-[(2R,4R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |