2-[(4-chlorophenyl)sulfonyl]acetamide structure
|
Common Name | 2-[(4-chlorophenyl)sulfonyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 36967-94-9 | Molecular Weight | 233.67200 | |
| Density | 1.456g/cm3 | Boiling Point | 496.3ºC at 760 mmHg | |
| Molecular Formula | C8H8ClNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | 2-(4-chlorophenyl)sulfonylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 496.3ºC at 760 mmHg |
| Molecular Formula | C8H8ClNO3S |
| Molecular Weight | 233.67200 |
| Flash Point | 254ºC |
| Exact Mass | 232.99100 |
| PSA | 86.60000 |
| LogP | 2.82950 |
| Index of Refraction | 1.579 |
| InChIKey | VWTPVZIHFJROMP-UHFFFAOYSA-N |
| SMILES | NC(=O)CS(=O)(=O)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-[(4-chlorophe... CAS#:36967-94-9 |
| Literature: Troeger; Hille Journal fuer Praktische Chemie (Leipzig), 1905 , vol. <2> 71, p. 232 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Chlor-phenylsulfon)-essigsaeure-amid |
| (4-chloro-benzenesulfonyl)-acetic acid amide |
| 2-[(4-chlorophenyl)sulfonyl]acetamide |
| (4-Chlor-benzolsulfonyl)-essigsaeure-amid |
| p-Chlorphenylsulfonylacetamid |