(2,3,4,5,6-pentachlorophenyl) 2-hydroxybenzoate structure
|
Common Name | (2,3,4,5,6-pentachlorophenyl) 2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 36994-69-1 | Molecular Weight | 386.44200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H5Cl5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,4,5,6-pentachlorophenyl) 2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H5Cl5O3 |
|---|---|
| Molecular Weight | 386.44200 |
| Exact Mass | 383.86800 |
| PSA | 46.53000 |
| LogP | 5.87840 |
| InChIKey | ZMZPNTFEPFRJHW-UHFFFAOYSA-N |
| SMILES | O=C(Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl)c1ccccc1O |
| HS Code | 2918230000 |
|---|
| HS Code | 2918230000 |
|---|---|
| Summary | 2918230000 other esters of salicylic acid and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Pentachlorophenyl salicylate |
| 2-hydroxy-benzoic acid,pentachlorophenyl ester |