8-chloro-3,10-dimethylbenzo[g]pteridine-2,4-dione structure
|
Common Name | 8-chloro-3,10-dimethylbenzo[g]pteridine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 36995-96-7 | Molecular Weight | 276.67800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-chloro-3,10-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9ClN4O2 |
|---|---|
| Molecular Weight | 276.67800 |
| Exact Mass | 276.04100 |
| PSA | 69.78000 |
| LogP | 0.83380 |
| InChIKey | PDSJFFGCLPMCIW-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)nc2n(C)c3cc(Cl)ccc3nc-2c1=O |
|
~79%
8-chloro-3,10-d... CAS#:36995-96-7 |
| Literature: Yoneda; Shinozuka; Hiromatsu; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 12 p. 3576 - 3583 |
|
~73%
8-chloro-3,10-d... CAS#:36995-96-7 |
| Literature: Yoneda; Shinozuka; Hiromatsu; et al. Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 12 p. 3576 - 3583 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8-chloro-3,10-dimethyl-10H-benzo[g]pteridine-2,4-dione |
| 8-chloro-3,10-dimethylisoalloxazine |
| 7-Chlor-3,10-dimethylisoalloxazin |
| Benzo[g]pteridine-2,4(3H,10H)-dione,8-chloro-3,10-dimethyl |
| 8-Chlor-3,10-Dimethylisoalloxazin |