Benzo(g)pteridine-2,4(3H,10H)-dione, 3,10-dimethyl structure
|
Common Name | Benzo(g)pteridine-2,4(3H,10H)-dione, 3,10-dimethyl | ||
|---|---|---|---|---|
| CAS Number | 4074-59-3 | Molecular Weight | 242.23300 | |
| Density | 1.47g/cm3 | Boiling Point | 388.3ºC at 760mmHg | |
| Molecular Formula | C12H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.6ºC | |
| Name | 3,10-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 388.3ºC at 760mmHg |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.23300 |
| Flash Point | 188.6ºC |
| Exact Mass | 242.08000 |
| PSA | 69.78000 |
| LogP | 0.18040 |
| Index of Refraction | 1.73 |
| InChIKey | QWMOSGTYFROAOL-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)nc2n(C)c3ccccc3nc-2c1=O |
| HS Code | 2933990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,10-Dimethylisoalloxazin (VII) |
| Benzo[g]pteridine-2,4(3H,10H)-dione,3,10-dimethyl |
| N3,N10-dimethylisoalloxazine |
| 3,10-Dimethyl-isoalloxazin |
| 3,10-dimethyl-10H-benzo[g]pteridine-2,4-dione |
| dimethyl-3,10-iso-alloxazine |
| 3,10-Dimethyl-10H-benzo[g]pteridin-2,4-dion |
| 3,10-dimethylisoalloxazine |