1,3-bis(4-fluorophenyl)urea structure
|
Common Name | 1,3-bis(4-fluorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 370-22-9 | Molecular Weight | 248.22800 | |
| Density | 1.392g/cm3 | Boiling Point | 260.3ºC at 760 mmHg | |
| Molecular Formula | C13H10F2N2O | Melting Point | 267 °C | |
| MSDS | N/A | Flash Point | 111.3ºC | |
| Name | 1,3-bis(4-fluorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 260.3ºC at 760 mmHg |
| Melting Point | 267 °C |
| Molecular Formula | C13H10F2N2O |
| Molecular Weight | 248.22800 |
| Flash Point | 111.3ºC |
| Exact Mass | 248.07600 |
| PSA | 41.13000 |
| LogP | 3.75480 |
| Index of Refraction | 1.65 |
| InChIKey | VEURDHASKSZBOL-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(F)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N'-bis(p-fluorophenyl)urea |
| 4,4'-Difluor-diphenylcarbamid |
| 1,3-BIS(4-FLUOROPHENYL)UREA |
| bis(4-fluorophenyl)urea |
| N,N'-Di-(4-Fluorphenyl)-harnstoff |
| N,N'-Bis-(4-fluor-phenyl)-harnstoff |
| N,N'-Bis(4-fluorophenyl)urea |