trimethyl(2-phenoxyethyl)azanium,bromide structure
|
Common Name | trimethyl(2-phenoxyethyl)azanium,bromide | ||
|---|---|---|---|---|
| CAS Number | 370-83-2 | Molecular Weight | 260.17100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H18BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | trimethyl(2-phenoxyethyl)azanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H18BrNO |
|---|---|
| Molecular Weight | 260.17100 |
| Exact Mass | 259.05700 |
| PSA | 9.23000 |
| InChIKey | FXCYSFBPSZWZJS-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCOc1ccccc1.[Br-] |
| HS Code | 2923900090 |
|---|
|
~79%
trimethyl(2-phe... CAS#:370-83-2 |
| Literature: Guendisch, Daniela; Andrae, Matthias; Munoz, Lenka; Cristina Tilotta, Maria Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 18 p. 4953 - 4962 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Trimethyl(2-phenoxyethyl)ammonium bromide |
| AMMONIUM,(2-PHENOXYETHYL)TRIMETHYL-,BROMIDE |
| 2-phenoxyethyltrimethylammonium bromide |
| Choline phenyl ether bromide |
| Phenoxyethyltrimethylammonium bromide |
| O-Phenyl-cholin-bromid |
| Phenylcholine ether bromide |
| Trimethyl-<2-phenoxy-aethyl>-ammonium-bromid |
| n,n,n-trimethyl-2-phenoxyethanaminium bromide |