1-(dimethylamino)-2,3-diphenylpentan-3-ol,hydrochloride
Modify Date: 2025-09-22 11:06:35
1-(dimethylamino)-2,3-diphenylpentan-3-ol,hydrochloride structure
|
Common Name | 1-(dimethylamino)-2,3-diphenylpentan-3-ol,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 37013-30-2 | Molecular Weight | 319.86900 | |
| Density | N/A | Boiling Point | 413.6ºC at 760 mmHg | |
| Molecular Formula | C19H26ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.9ºC | |
| Name | 1-(dimethylamino)-2,3-diphenylpentan-3-ol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 413.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H26ClNO |
| Molecular Weight | 319.86900 |
| Flash Point | 157.9ºC |
| Exact Mass | 319.17000 |
| PSA | 23.47000 |
| LogP | 4.43160 |
| InChIKey | BLVXNGSLGLMKMX-UHFFFAOYSA-N |
| SMILES | CCC(O)(c1ccccc1)C(CN(C)C)c1ccccc1.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Dimethylamino-2,3-diphenyl-pentan-3-ol hydrochlorid [German] |
| 1-(dimethylamino)-2,3-diphenylpentan-3-ol hydrochloride(1:1) |