Octamethyltrisilane structure
|
Common Name | Octamethyltrisilane | ||
|---|---|---|---|---|
| CAS Number | 3704-44-7 | Molecular Weight | 204.53300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H24Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | octamethyl-Trisilane |
|---|
| Molecular Formula | C8H24Si3 |
|---|---|
| Molecular Weight | 204.53300 |
| Exact Mass | 204.11900 |
| LogP | 3.52800 |
| InChIKey | DDIMPUQNMJIVKL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)[Si](C)(C)[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |