diethyl 2-[(methyl-phenyl-amino)methylidene]propanedioate structure
|
Common Name | diethyl 2-[(methyl-phenyl-amino)methylidene]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 37041-15-9 | Molecular Weight | 277.31600 | |
| Density | 1.139g/cm3 | Boiling Point | 332.8ºC at 760 mmHg | |
| Molecular Formula | C15H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.1ºC | |
| Name | diethyl 2-[(N-methylanilino)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 332.8ºC at 760 mmHg |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.31600 |
| Flash Point | 155.1ºC |
| Exact Mass | 277.13100 |
| PSA | 55.84000 |
| LogP | 2.13290 |
| Index of Refraction | 1.54 |
| InChIKey | GIDDHVVEGZZYOD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=CN(C)c1ccccc1)C(=O)OCC |
|
~%
diethyl 2-[(met... CAS#:37041-15-9 |
| Literature: Brion, Jean-Daniel; Israel, Lucien; Le Ridant, Alain; Harpey, Catherine; Rabhi, Cherif; Kaloun, El Bachir Patent: US2006/63801 A1, 2006 ; Location in patent: Page/Page column 7 ; |
|
~92%
diethyl 2-[(met... CAS#:37041-15-9 |
| Literature: Huppatz, John L.; Phillips, John N.; Rattigan, Barbara M. Agricultural and Biological Chemistry, 1981 , vol. 45, # 12 p. 2769 - 2774 |
| diethyl N-methyl-N-phenylaminomethylenemalonate |