Ethanone, 2,2'-sulfonylbis[1-phenyl- structure
|
Common Name | Ethanone, 2,2'-sulfonylbis[1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 3708-08-5 | Molecular Weight | 302.34500 | |
| Density | 1.289g/cm3 | Boiling Point | 553.7ºC at 760 mmHg | |
| Molecular Formula | C16H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 368ºC | |
| Name | 2-phenacylsulfonyl-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 553.7ºC at 760 mmHg |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.34500 |
| Flash Point | 368ºC |
| Exact Mass | 302.06100 |
| PSA | 76.66000 |
| LogP | 3.24780 |
| Index of Refraction | 1.589 |
| InChIKey | VXZKWVJFIXGRKM-UHFFFAOYSA-N |
| SMILES | O=C(CS(=O)(=O)CC(=O)c1ccccc1)c1ccccc1 |
|
~%
Ethanone, 2,2'-... CAS#:3708-08-5 |
| Literature: Fromm; Flaschen Justus Liebigs Annalen der Chemie, 1912 , vol. 394, p. 310 |
|
~%
Ethanone, 2,2'-... CAS#:3708-08-5 |
| Literature: Posner, Gary H.; Wang, Dasong; Gonzalez, Lluisa; Tao, Xueliang; Cumming, Jared N.; Klinedinst, Donna; Shapiro, Theresa A. Tetrahedron Letters, 1996 , vol. 37, # 6 p. 815 - 818 |
|
~57%
Ethanone, 2,2'-... CAS#:3708-08-5 |
| Literature: Jarvis, William F.; Hoey, Michael D.; Finocchio, Alfred L.; Dittmer, Donald C. Journal of Organic Chemistry, 1988 , vol. 53, # 24 p. 5750 - 5756 |
| 1,1'-diphenyl-2,2'-sulfonyl-bis-ethanone |
| bis(phenacyl)sulfone |
| bis(benzoylmethyl)sulfone |
| Diphenacyl-sulfon |
| Diphenacyl sulfone |
| Diphenacyl sulphone |
| 2,2'-sulfonylbis(1-phenylethanone) |